C29H38O5 — CID 101416780
(1R,2R,5R,11R,12S,15R,16R)-16-[2-(3,3-dimethyloxiran-2-yl)-2,3-dihydrofuran-4-yl]-6,6,11-trimethyl-7-oxapentacyclo[13.3.1.01,15.02,12.05,11]nonadec-9-ene-3,8-dione (PubChem CID 101416780) has the molecular formula C29H38O5 and a molecular weight of 466.62 g/mol. Its IUPAC name is (1R,2R,5R,11R,12S,15R,16R)-16-[2-(3,3-dimethyloxiran-2-yl)-2,3-dihydrofuran-4-yl]-6,6,11-trimethyl-7-oxapentacyclo[13.3.1.01,15.02,12.05,11]nonadec-9-ene-3,8-dione.
| Compound Name | (1R,2R,5R,11R,12S,15R,16R)-16-[2-(3,3-dimethyloxiran-2-yl)-2,3-dihydrofuran-4-yl]-6,6,11-trimethyl-7-oxapentacyclo[13.3.1.01,15.02,12.05,11]nonadec-9-ene-3,8-dione |
|---|---|
| PubChem CID | 101416780 |
| Molecular Formula | C29H38O5 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | (1R,2R,5R,11R,12S,15R,16R)-16-[2-(3,3-dimethyloxiran-2-yl)-2,3-dihydrofuran-4-yl]-6,6,11-trimethyl-7-oxapentacyclo[13.3.1.01,15.02,12.05,11]nonadec-9-ene-3,8-dione |
| SMILES | CC1(C)OC1C1CC([C@@H]2CC[C@]34C[C@]23CC[C@H]2[C@H]4C(=O)C[C@H]3C(C)(C)OC(=O)C=C[C@]23C)=CO1 |
| InChI | InChI=1S/C29H38O5/c1-25(2)21-13-19(30)23-18(27(21,5)9-8-22(31)33-25)7-10-28-15-29(23,28)11-6-17(28)16-12-20(32-14-16)24-26(3,4)34-24/h8-9,14,17-18,20-21,23-24H,6-7,10-13,15H2,1-5H3/t17-,18-,20?,21-,23-,24?,27+,28+,29+/m0/s1 |
| InChIKey | SJHHXAVHRCKADP-JOXRNYKPSA-N |
| XLogP | 5.14 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|