C25H32O7 — CID 163063997
(1S,4R,10S,11S,13R,15S,16R,17S,21R)-16-hydroxy-5,5,10,13,15-pentamethyl-6,19,22-trioxahexacyclo[13.7.1.01,11.04,10.013,21.017,21]tricos-8-ene-7,14,18-trione (PubChem CID 163063997) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is (1S,4R,10S,11S,13R,15S,16R,17S,21R)-16-hydroxy-5,5,10,13,15-pentamethyl-6,19,22-trioxahexacyclo[13.7.1.01,11.04,10.013,21.017,21]tricos-8-ene-7,14,18-trione.
| Compound Name | (1S,4R,10S,11S,13R,15S,16R,17S,21R)-16-hydroxy-5,5,10,13,15-pentamethyl-6,19,22-trioxahexacyclo[13.7.1.01,11.04,10.013,21.017,21]tricos-8-ene-7,14,18-trione |
|---|---|
| PubChem CID | 163063997 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (1S,4R,10S,11S,13R,15S,16R,17S,21R)-16-hydroxy-5,5,10,13,15-pentamethyl-6,19,22-trioxahexacyclo[13.7.1.01,11.04,10.013,21.017,21]tricos-8-ene-7,14,18-trione |
| SMILES | CC1(C)OC(=O)C=C[C@]2(C)[C@@H]3C[C@@]4(C)C(=O)[C@@]5(C)C[C@]3(CC[C@@H]12)O[C@@]41COC(=O)[C@H]1[C@H]5O |
| InChI | InChI=1S/C25H32O7/c1-20(2)13-6-9-24-11-22(4)17(27)16-18(28)30-12-25(16,32-24)23(5,19(22)29)10-14(24)21(13,3)8-7-15(26)31-20/h7-8,13-14,16-17,27H,6,9-12H2,1-5H3/t13-,14-,16+,17+,21-,22-,23-,24-,25+/m0/s1 |
| InChIKey | QXZNFWAPDOLGEF-ABGUQTIISA-N |
| XLogP | 2.34 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |