C25H32O7 — CID 146682198
(1R,2S,5S,11S,12S,14R,17R,18R)-17-hydroxy-2,6,6,11,14,18-hexamethyl-21-methylidene-7,15,19-trioxapentacyclo[12.6.1.01,17.02,12.05,11]henicos-9-ene-8,16,20-trione (PubChem CID 146682198) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is (1R,2S,5S,11S,12S,14R,17R,18R)-17-hydroxy-2,6,6,11,14,18-hexamethyl-21-methylidene-7,15,19-trioxapentacyclo[12.6.1.01,17.02,12.05,11]henicos-9-ene-8,16,20-trione.
| Compound Name | (1R,2S,5S,11S,12S,14R,17R,18R)-17-hydroxy-2,6,6,11,14,18-hexamethyl-21-methylidene-7,15,19-trioxapentacyclo[12.6.1.01,17.02,12.05,11]henicos-9-ene-8,16,20-trione |
|---|---|
| PubChem CID | 146682198 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (1R,2S,5S,11S,12S,14R,17R,18R)-17-hydroxy-2,6,6,11,14,18-hexamethyl-21-methylidene-7,15,19-trioxapentacyclo[12.6.1.01,17.02,12.05,11]henicos-9-ene-8,16,20-trione |
| SMILES | C=C1[C@@]23C(=O)O[C@H](C)[C@@]2(O)C(=O)O[C@]1(C)C[C@H]1[C@]2(C)C=CC(=O)OC(C)(C)[C@H]2CC[C@@]13C |
| InChI | InChI=1S/C25H32O7/c1-13-23(7)12-16-21(5)10-9-17(26)31-20(3,4)15(21)8-11-22(16,6)24(13)18(27)30-14(2)25(24,29)19(28)32-23/h9-10,14-16,29H,1,8,11-12H2,2-7H3/t14-,15-,16+,21-,22+,23-,24+,25-/m1/s1 |
| InChIKey | LZBBJWOZVAEILY-HHCBSSDPSA-N |
| XLogP | 2.86 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|