C22H32O3 — CID 73311341
13-hydroxy-4,4,8,10,14-pentamethyl-5,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione (PubChem CID 73311341) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 13-hydroxy-4,4,8,10,14-pentamethyl-5,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | 13-hydroxy-4,4,8,10,14-pentamethyl-5,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 73311341 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 13-hydroxy-4,4,8,10,14-pentamethyl-5,6,7,9,11,12,15,16-octahydrocyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC1(C)C(=O)C=CC2(C)C1CCC1(C)C2CCC2(O)C(=O)CCC21C |
| InChI | InChI=1S/C22H32O3/c1-18(2)14-6-11-20(4)15(19(14,3)10-8-16(18)23)7-13-22(25)17(24)9-12-21(20,22)5/h8,10,14-15,25H,6-7,9,11-13H2,1-5H3 |
| InChIKey | IIJNLYZZSXXPOF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |