C12H14N2O2 — CID 101417079
(8R,9R,11E)-11-ethylidene-8-hydroxy-1,3-diazatricyclo[7.3.0.03,7]dodeca-4,6-dien-2-one (PubChem CID 101417079) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is (8R,9R,11E)-11-ethylidene-8-hydroxy-1,3-diazatricyclo[7.3.0.03,7]dodeca-4,6-dien-2-one.
| Compound Name | (8R,9R,11E)-11-ethylidene-8-hydroxy-1,3-diazatricyclo[7.3.0.03,7]dodeca-4,6-dien-2-one |
|---|---|
| PubChem CID | 101417079 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (8R,9R,11E)-11-ethylidene-8-hydroxy-1,3-diazatricyclo[7.3.0.03,7]dodeca-4,6-dien-2-one |
| SMILES | C/C=C1\C[C@@H]2[C@@H](O)c3cccn3C(=O)N2C1 |
| InChI | InChI=1S/C12H14N2O2/c1-2-8-6-10-11(15)9-4-3-5-13(9)12(16)14(10)7-8/h2-5,10-11,15H,6-7H2,1H3/b8-2+/t10-,11+/m1/s1 |
| InChIKey | NFQZCYXXXYCQCS-ARQZFUFXSA-N |
| XLogP | 1.52 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|