C27H36N2O7 — CID 101417520
tert-butyl 3-[(Z)-3-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoyl]indole-1-carboxylate (PubChem CID 101417520) has the molecular formula C27H36N2O7 and a molecular weight of 500.59 g/mol. Its IUPAC name is tert-butyl 3-[(Z)-3-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(Z)-3-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 101417520 |
| Molecular Formula | C27H36N2O7 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | tert-butyl 3-[(Z)-3-ethoxycarbonyl-6-[(2-methylpropan-2-yl)oxycarbonylamino]hex-3-enoyl]indole-1-carboxylate |
| SMILES | CCOC(=O)/C(=C\CCNC(=O)OC(C)(C)C)CC(=O)c1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C27H36N2O7/c1-8-34-23(31)18(12-11-15-28-24(32)35-26(2,3)4)16-22(30)20-17-29(25(33)36-27(5,6)7)21-14-10-9-13-19(20)21/h9-10,12-14,17H,8,11,15-16H2,1-7H3,(H,28,32)/b18-12- |
| InChIKey | JYYGZAAFDVKXDN-PDGQHHTCSA-N |
| XLogP | 5.40 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|