C33H35ClO4 — CID 101420605
(2R,3R,4S)-5-chloro-6-hex-1-ynyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran (PubChem CID 101420605) has the molecular formula C33H35ClO4 and a molecular weight of 531.09 g/mol. Its IUPAC name is (2R,3R,4S)-5-chloro-6-hex-1-ynyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran.
| Compound Name | (2R,3R,4S)-5-chloro-6-hex-1-ynyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 101420605 |
| Molecular Formula | C33H35ClO4 |
| Molecular Weight | 531.09 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | (2R,3R,4S)-5-chloro-6-hex-1-ynyl-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)-3,4-dihydro-2H-pyran |
| SMILES | CCCCC#CC1=C(Cl)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C33H35ClO4/c1-2-3-4-14-21-29-31(34)33(37-24-28-19-12-7-13-20-28)32(36-23-27-17-10-6-11-18-27)30(38-29)25-35-22-26-15-8-5-9-16-26/h5-13,15-20,30,32-33H,2-4,22-25H2,1H3/t30-,32-,33-/m1/s1 |
| InChIKey | ZOAFNDVCLYTQEO-JORIVFIJSA-N |
| XLogP | 7.42 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.09 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|