C20H24BrF3N2O4 — CID 101422469
tert-butyl 2-(4-bromo-N-prop-2-enoxyanilino)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]acetate (PubChem CID 101422469) has the molecular formula C20H24BrF3N2O4 and a molecular weight of 493.32 g/mol. Its IUPAC name is tert-butyl 2-(4-bromo-N-prop-2-enoxyanilino)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]acetate.
| Compound Name | tert-butyl 2-(4-bromo-N-prop-2-enoxyanilino)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]acetate |
|---|---|
| PubChem CID | 101422469 |
| Molecular Formula | C20H24BrF3N2O4 |
| Molecular Weight | 493.32 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | tert-butyl 2-(4-bromo-N-prop-2-enoxyanilino)-2-[prop-2-enyl-(2,2,2-trifluoroacetyl)amino]acetate |
| SMILES | C=CCON(c1ccc(Br)cc1)C(C(=O)OC(C)(C)C)N(CC=C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C20H24BrF3N2O4/c1-6-12-25(18(28)20(22,23)24)16(17(27)30-19(3,4)5)26(29-13-7-2)15-10-8-14(21)9-11-15/h6-11,16H,1-2,12-13H2,3-5H3 |
| InChIKey | UFVUFOHPUMQKDV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|