C7H13NO3 — CID 101424794
(2R,3R,4S)-4-amino-2,3-dihydroxycycloheptan-1-one (PubChem CID 101424794) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (2R,3R,4S)-4-amino-2,3-dihydroxycycloheptan-1-one.
| Compound Name | (2R,3R,4S)-4-amino-2,3-dihydroxycycloheptan-1-one |
|---|---|
| PubChem CID | 101424794 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (2R,3R,4S)-4-amino-2,3-dihydroxycycloheptan-1-one |
| SMILES | N[C@H]1CCCC(=O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H13NO3/c8-4-2-1-3-5(9)7(11)6(4)10/h4,6-7,10-11H,1-3,8H2/t4-,6+,7-/m0/s1 |
| InChIKey | JCZCPJBMIUULPL-JHYUDYDFSA-N |
| XLogP | -1.21 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |