C22H31NO2 — CID 101425692
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-tert-butyl-4-isocyanobenzoate (PubChem CID 101425692) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-tert-butyl-4-isocyanobenzoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-tert-butyl-4-isocyanobenzoate |
|---|---|
| PubChem CID | 101425692 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 3-tert-butyl-4-isocyanobenzoate |
| SMILES | [C-]#[N+]c1ccc(C(=O)O[C@@H]2C[C@H](C)CCC2C(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C22H31NO2/c1-14(2)17-10-8-15(3)12-20(17)25-21(24)16-9-11-19(23-7)18(13-16)22(4,5)6/h9,11,13-15,17,20H,8,10,12H2,1-6H3/t15-,17?,20-/m1/s1 |
| InChIKey | QVDMNUCQBMMUPO-QMBUQHDCSA-N |
| XLogP | 6.15 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|