C31H28O6 — CID 101427831
3-O-[[3,5-bis(phenylmethoxy)phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 101427831) has the molecular formula C31H28O6 and a molecular weight of 496.56 g/mol. Its IUPAC name is 3-O-[[3,5-bis(phenylmethoxy)phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | 3-O-[[3,5-bis(phenylmethoxy)phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101427831 |
| Molecular Formula | C31H28O6 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 3-O-[[3,5-bis(phenylmethoxy)phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OCc2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)C2C=CC1C2 |
| InChI | InChI=1S/C31H28O6/c1-34-30(32)28-24-12-13-25(16-24)29(28)31(33)37-20-23-14-26(35-18-21-8-4-2-5-9-21)17-27(15-23)36-19-22-10-6-3-7-11-22/h2-15,17,24-25H,16,18-20H2,1H3 |
| InChIKey | ATKAVSSQGFELBA-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|