C59H52O10 — CID 101427832
3-O-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate (PubChem CID 101427832) has the molecular formula C59H52O10 and a molecular weight of 921.06 g/mol. Its IUPAC name is 3-O-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate.
| Compound Name | 3-O-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101427832 |
| Molecular Formula | C59H52O10 |
| Molecular Weight | 921.06 g/mol |
| Exact Mass | 920.36 |
| IUPAC Name | 3-O-[[3,5-bis[[3,5-bis(phenylmethoxy)phenyl]methoxy]phenyl]methyl] 2-O-methyl bicyclo[2.2.1]hepta-2,5-diene-2,3-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OCc2cc(OCc3cc(OCc4ccccc4)cc(OCc4ccccc4)c3)cc(OCc3cc(OCc4ccccc4)cc(OCc4ccccc4)c3)c2)C2C=CC1C2 |
| InChI | InChI=1S/C59H52O10/c1-62-58(60)56-48-22-23-49(30-48)57(56)59(61)69-40-47-28-54(67-38-45-24-50(63-34-41-14-6-2-7-15-41)31-51(25-45)64-35-42-16-8-3-9-17-42)33-55(29-47)68-39-46-26-52(65-36-43-18-10-4-11-19-43)32-53(27-46)66-37-44-20-12-5-13-21-44/h2-29,31-33,48-49H,30,34-40H2,1H3 |
| InChIKey | AXZVJWCEHVVCGF-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.06 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|