C18H20O4 — CID 101429110
ethyl (E)-3-[(2S,3S)-3,6-dimethyl-4-oxo-2-phenyl-2,3-dihydropyran-5-yl]prop-2-enoate (PubChem CID 101429110) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3S)-3,6-dimethyl-4-oxo-2-phenyl-2,3-dihydropyran-5-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3S)-3,6-dimethyl-4-oxo-2-phenyl-2,3-dihydropyran-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 101429110 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | ethyl (E)-3-[(2S,3S)-3,6-dimethyl-4-oxo-2-phenyl-2,3-dihydropyran-5-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1=C(C)O[C@H](c2ccccc2)[C@H](C)C1=O |
| InChI | InChI=1S/C18H20O4/c1-4-21-16(19)11-10-15-13(3)22-18(12(2)17(15)20)14-8-6-5-7-9-14/h5-12,18H,4H2,1-3H3/b11-10+/t12-,18+/m1/s1 |
| InChIKey | BHVMJCPHLUPANV-PLKCNYNGSA-N |
| XLogP | 3.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|