C20H40OS2Si — CID 101430148
tert-butyl-dimethyl-[5-(4-pent-4-enyl-1,3-dithian-2-yl)pentan-2-yloxy]silane (PubChem CID 101430148) has the molecular formula C20H40OS2Si and a molecular weight of 388.76 g/mol. Its IUPAC name is tert-butyl-dimethyl-[5-(4-pent-4-enyl-1,3-dithian-2-yl)pentan-2-yloxy]silane.
| Compound Name | tert-butyl-dimethyl-[5-(4-pent-4-enyl-1,3-dithian-2-yl)pentan-2-yloxy]silane |
|---|---|
| PubChem CID | 101430148 |
| Molecular Formula | C20H40OS2Si |
| Molecular Weight | 388.76 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | tert-butyl-dimethyl-[5-(4-pent-4-enyl-1,3-dithian-2-yl)pentan-2-yloxy]silane |
| SMILES | C=CCCCC1CCSC(CCCC(C)O[Si](C)(C)C(C)(C)C)S1 |
| InChI | InChI=1S/C20H40OS2Si/c1-8-9-10-13-18-15-16-22-19(23-18)14-11-12-17(2)21-24(6,7)20(3,4)5/h8,17-19H,1,9-16H2,2-7H3 |
| InChIKey | ADPNCHGPEDAXMD-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.76 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|