C15H30OS2Si — CID 11336143
[(2R)-1-(1,3-dithian-2-yl)pent-4-en-2-yl]oxy-triethylsilane (PubChem CID 11336143) has the molecular formula C15H30OS2Si and a molecular weight of 318.62 g/mol. Its IUPAC name is [(2R)-1-(1,3-dithian-2-yl)pent-4-en-2-yl]oxy-triethylsilane.
| Compound Name | [(2R)-1-(1,3-dithian-2-yl)pent-4-en-2-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11336143 |
| Molecular Formula | C15H30OS2Si |
| Molecular Weight | 318.62 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [(2R)-1-(1,3-dithian-2-yl)pent-4-en-2-yl]oxy-triethylsilane |
| SMILES | C=CC[C@H](CC1SCCCS1)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H30OS2Si/c1-5-10-14(13-15-17-11-9-12-18-15)16-19(6-2,7-3)8-4/h5,14-15H,1,6-13H2,2-4H3/t14-/m1/s1 |
| InChIKey | TUBPPSUHACQNEQ-CQSZACIVSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.62 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|