C12H22OS2Si — CID 138971354
[(2S,3S)-3-ethenyl-5,9-dithiaspiro[3.5]nonan-2-yl]oxy-trimethylsilane (PubChem CID 138971354) has the molecular formula C12H22OS2Si and a molecular weight of 274.53 g/mol. Its IUPAC name is [(2S,3S)-3-ethenyl-5,9-dithiaspiro[3.5]nonan-2-yl]oxy-trimethylsilane.
| Compound Name | [(2S,3S)-3-ethenyl-5,9-dithiaspiro[3.5]nonan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 138971354 |
| Molecular Formula | C12H22OS2Si |
| Molecular Weight | 274.53 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | [(2S,3S)-3-ethenyl-5,9-dithiaspiro[3.5]nonan-2-yl]oxy-trimethylsilane |
| SMILES | C=C[C@H]1[C@@H](O[Si](C)(C)C)CC12SCCCS2 |
| InChI | InChI=1S/C12H22OS2Si/c1-5-10-11(13-16(2,3)4)9-12(10)14-7-6-8-15-12/h5,10-11H,1,6-9H2,2-4H3/t10-,11-/m0/s1 |
| InChIKey | YOZQULHBZLOJLK-QWRGUYRKSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|