C17H34OS2Si — CID 102576974
tert-butyl-[(2S,3R,4R)-2-(1,3-dithian-2-yl)-4-methylhex-5-en-3-yl]oxy-dimethylsilane (PubChem CID 102576974) has the molecular formula C17H34OS2Si and a molecular weight of 346.68 g/mol. Its IUPAC name is tert-butyl-[(2S,3R,4R)-2-(1,3-dithian-2-yl)-4-methylhex-5-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3R,4R)-2-(1,3-dithian-2-yl)-4-methylhex-5-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 102576974 |
| Molecular Formula | C17H34OS2Si |
| Molecular Weight | 346.68 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl-[(2S,3R,4R)-2-(1,3-dithian-2-yl)-4-methylhex-5-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C1SCCCS1 |
| InChI | InChI=1S/C17H34OS2Si/c1-9-13(2)15(18-21(7,8)17(4,5)6)14(3)16-19-11-10-12-20-16/h9,13-16H,1,10-12H2,2-8H3/t13-,14+,15-/m1/s1 |
| InChIKey | ZNJWGOOIRUCAHQ-QLFBSQMISA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|