C15H30OS2Si — CID 53253924
tert-butyl-[(3S,4R)-4-(1,3-dithian-2-yl)pent-1-en-3-yl]oxy-dimethylsilane (PubChem CID 53253924) has the molecular formula C15H30OS2Si and a molecular weight of 318.62 g/mol. Its IUPAC name is tert-butyl-[(3S,4R)-4-(1,3-dithian-2-yl)pent-1-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,4R)-4-(1,3-dithian-2-yl)pent-1-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 53253924 |
| Molecular Formula | C15H30OS2Si |
| Molecular Weight | 318.62 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | tert-butyl-[(3S,4R)-4-(1,3-dithian-2-yl)pent-1-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1SCCCS1 |
| InChI | InChI=1S/C15H30OS2Si/c1-8-13(16-19(6,7)15(3,4)5)12(2)14-17-10-9-11-18-14/h8,12-14H,1,9-11H2,2-7H3/t12-,13+/m1/s1 |
| InChIKey | XAXZSROKCOCERK-OLZOCXBDSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.62 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|