C10H22OS2Si — CID 11075904
5,5-bis(methylsulfanyl)pent-1-en-3-yloxy-trimethylsilane (PubChem CID 11075904) has the molecular formula C10H22OS2Si and a molecular weight of 250.50 g/mol. Its IUPAC name is 5,5-bis(methylsulfanyl)pent-1-en-3-yloxy-trimethylsilane.
| Compound Name | 5,5-bis(methylsulfanyl)pent-1-en-3-yloxy-trimethylsilane |
|---|---|
| PubChem CID | 11075904 |
| Molecular Formula | C10H22OS2Si |
| Molecular Weight | 250.50 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 5,5-bis(methylsulfanyl)pent-1-en-3-yloxy-trimethylsilane |
| SMILES | C=CC(CC(SC)SC)O[Si](C)(C)C |
| InChI | InChI=1S/C10H22OS2Si/c1-7-9(11-14(4,5)6)8-10(12-2)13-3/h7,9-10H,1,8H2,2-6H3 |
| InChIKey | CLNWPCWVOMWLPA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|