C11H22OS2Si — CID 11747435
1-(1,3-dithian-2-yl)but-3-en-2-yloxy-trimethylsilane (PubChem CID 11747435) has the molecular formula C11H22OS2Si and a molecular weight of 262.52 g/mol. Its IUPAC name is 1-(1,3-dithian-2-yl)but-3-en-2-yloxy-trimethylsilane.
| Compound Name | 1-(1,3-dithian-2-yl)but-3-en-2-yloxy-trimethylsilane |
|---|---|
| PubChem CID | 11747435 |
| Molecular Formula | C11H22OS2Si |
| Molecular Weight | 262.52 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(1,3-dithian-2-yl)but-3-en-2-yloxy-trimethylsilane |
| SMILES | C=CC(CC1SCCCS1)O[Si](C)(C)C |
| InChI | InChI=1S/C11H22OS2Si/c1-5-10(12-15(2,3)4)9-11-13-7-6-8-14-11/h5,10-11H,1,6-9H2,2-4H3 |
| InChIKey | NALWRYUYFHEFTJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|