C15H18N2O3 — CID 101433399
(1-acetylindol-3-yl) N,N-diethylcarbamate (PubChem CID 101433399) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (1-acetylindol-3-yl) N,N-diethylcarbamate.
| Compound Name | (1-acetylindol-3-yl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 101433399 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (1-acetylindol-3-yl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cn(C(C)=O)c2ccccc12 |
| InChI | InChI=1S/C15H18N2O3/c1-4-16(5-2)15(19)20-14-10-17(11(3)18)13-9-7-6-8-12(13)14/h6-10H,4-5H2,1-3H3 |
| InChIKey | FHPLHZQRELVPRY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |