C13H16ClNO3 — CID 10945491
(2-acetyl-3-chlorophenyl) N,N-diethylcarbamate (PubChem CID 10945491) has the molecular formula C13H16ClNO3 and a molecular weight of 269.73 g/mol. Its IUPAC name is (2-acetyl-3-chlorophenyl) N,N-diethylcarbamate.
| Compound Name | (2-acetyl-3-chlorophenyl) N,N-diethylcarbamate |
|---|---|
| PubChem CID | 10945491 |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (2-acetyl-3-chlorophenyl) N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cccc(Cl)c1C(C)=O |
| InChI | InChI=1S/C13H16ClNO3/c1-4-15(5-2)13(17)18-11-8-6-7-10(14)12(11)9(3)16/h6-8H,4-5H2,1-3H3 |
| InChIKey | DHBYKJMOMBJZJP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |