C14H21ClFNO2 — CID 156722778
(3-chloro-4-fluoro-2-methylphenyl) N,N-diethylcarbamate;ethane (PubChem CID 156722778) has the molecular formula C14H21ClFNO2 and a molecular weight of 289.78 g/mol. Its IUPAC name is (3-chloro-4-fluoro-2-methylphenyl) N,N-diethylcarbamate;ethane.
| Compound Name | (3-chloro-4-fluoro-2-methylphenyl) N,N-diethylcarbamate;ethane |
|---|---|
| PubChem CID | 156722778 |
| Molecular Formula | C14H21ClFNO2 |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (3-chloro-4-fluoro-2-methylphenyl) N,N-diethylcarbamate;ethane |
| SMILES | CC.CCN(CC)C(=O)Oc1ccc(F)c(Cl)c1C |
| InChI | InChI=1S/C12H15ClFNO2.C2H6/c1-4-15(5-2)12(16)17-10-7-6-9(14)11(13)8(10)3;1-2/h6-7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | HOPLKYMBTRLZAH-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |