C17H18N2O2 — CID 165357789
9H-carbazol-4-yl N,N-diethylcarbamate (PubChem CID 165357789) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 9H-carbazol-4-yl N,N-diethylcarbamate.
| Compound Name | 9H-carbazol-4-yl N,N-diethylcarbamate |
|---|---|
| PubChem CID | 165357789 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 9H-carbazol-4-yl N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cccc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C17H18N2O2/c1-3-19(4-2)17(20)21-15-11-7-10-14-16(15)12-8-5-6-9-13(12)18-14/h5-11,18H,3-4H2,1-2H3 |
| InChIKey | ZNMDVMNKVQKPLG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |