C26H39BrN4OS — CID 10143432
[(1E)-cyclononen-1-yl]methyl-dimethyl-[3-[[2-(N-methylanilino)-1,3-thiazole-4-carbonyl]amino]propyl]azanium bromide (PubChem CID 10143432) has the molecular formula C26H39BrN4OS and a molecular weight of 535.60 g/mol. Its IUPAC name is [(1E)-cyclononen-1-yl]methyl-dimethyl-[3-[[2-(N-methylanilino)-1,3-thiazole-4-carbonyl]amino]propyl]azanium bromide.
| Compound Name | [(1E)-cyclononen-1-yl]methyl-dimethyl-[3-[[2-(N-methylanilino)-1,3-thiazole-4-carbonyl]amino]propyl]azanium bromide |
|---|---|
| PubChem CID | 10143432 |
| Molecular Formula | C26H39BrN4OS |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | [(1E)-cyclononen-1-yl]methyl-dimethyl-[3-[[2-(N-methylanilino)-1,3-thiazole-4-carbonyl]amino]propyl]azanium bromide |
| SMILES | CN(c1ccccc1)c1nc(C(=O)NCCC[N+](C)(C)C/C2=C/CCCCCCC2)cs1.[Br-] |
| InChI | InChI=1S/C26H38N4OS.BrH/c1-29(23-16-11-8-12-17-23)26-28-24(21-32-26)25(31)27-18-13-19-30(2,3)20-22-14-9-6-4-5-7-10-15-22;/h8,11-12,14,16-17,21H,4-7,9-10,13,15,18-20H2,1-3H3;1H/b22-14+; |
| InChIKey | ZFQWBAJZBLVRMP-CWUUNJJBSA-N |
| XLogP | 2.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|