C15H30O3Si — CID 101434585
8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methylideneoctan-2-one (PubChem CID 101434585) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is 8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methylideneoctan-2-one.
| Compound Name | 8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methylideneoctan-2-one |
|---|---|
| PubChem CID | 101434585 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-5-methylideneoctan-2-one |
| SMILES | C=C(CCC(C)=O)C(O)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-12(8-9-13(2)16)14(17)10-11-18-19(6,7)15(3,4)5/h14,17H,1,8-11H2,2-7H3 |
| InChIKey | NVQHYAYQZYTAJB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|