C19H34O4 — CID 101437138
(1R,4R,8S,9R)-4-(3,4-dihydroxypentyl)-4,8-dimethyltricyclo[6.3.1.02,5]dodecane-1,9-diol (PubChem CID 101437138) has the molecular formula C19H34O4 and a molecular weight of 326.48 g/mol. Its IUPAC name is (1R,4R,8S,9R)-4-(3,4-dihydroxypentyl)-4,8-dimethyltricyclo[6.3.1.02,5]dodecane-1,9-diol.
| Compound Name | (1R,4R,8S,9R)-4-(3,4-dihydroxypentyl)-4,8-dimethyltricyclo[6.3.1.02,5]dodecane-1,9-diol |
|---|---|
| PubChem CID | 101437138 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (1R,4R,8S,9R)-4-(3,4-dihydroxypentyl)-4,8-dimethyltricyclo[6.3.1.02,5]dodecane-1,9-diol |
| SMILES | CC(O)C(O)CC[C@]1(C)CC2C1CC[C@@]1(C)C[C@]2(O)CC[C@H]1O |
| InChI | InChI=1S/C19H34O4/c1-12(20)15(21)5-8-17(2)10-14-13(17)4-7-18(3)11-19(14,23)9-6-16(18)22/h12-16,20-23H,4-11H2,1-3H3/t12?,13?,14?,15?,16-,17-,18+,19-/m1/s1 |
| InChIKey | ZJHRWYCZTZWNRY-NHTAJSIISA-N |
| XLogP | 2.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |