C20H32O4 — CID 162921391
(1R,2S,3S,7S,10S,11R)-6-(hydroxymethyl)-10-methyl-4-(2-methylprop-1-enyl)tricyclo[8.3.1.02,7]tetradec-5-ene-1,3,11-triol (PubChem CID 162921391) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (1R,2S,3S,7S,10S,11R)-6-(hydroxymethyl)-10-methyl-4-(2-methylprop-1-enyl)tricyclo[8.3.1.02,7]tetradec-5-ene-1,3,11-triol.
| Compound Name | (1R,2S,3S,7S,10S,11R)-6-(hydroxymethyl)-10-methyl-4-(2-methylprop-1-enyl)tricyclo[8.3.1.02,7]tetradec-5-ene-1,3,11-triol |
|---|---|
| PubChem CID | 162921391 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (1R,2S,3S,7S,10S,11R)-6-(hydroxymethyl)-10-methyl-4-(2-methylprop-1-enyl)tricyclo[8.3.1.02,7]tetradec-5-ene-1,3,11-triol |
| SMILES | CC(C)=CC1C=C(CO)[C@H]2CC[C@@]3(C)C[C@](O)(CC[C@H]3O)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C20H32O4/c1-12(2)8-13-9-14(10-21)15-4-6-19(3)11-20(24,7-5-16(19)22)17(15)18(13)23/h8-9,13,15-18,21-24H,4-7,10-11H2,1-3H3/t13?,15-,16-,17+,18+,19+,20-/m1/s1 |
| InChIKey | QJNNQAWDYFHGRK-UPMSZIAASA-N |
| XLogP | 2.17 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|