C11H4F15N3O2 — CID 101439413
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)octanamide (PubChem CID 101439413) has the molecular formula C11H4F15N3O2 and a molecular weight of 495.14 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)octanamide.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)octanamide |
|---|---|
| PubChem CID | 101439413 |
| Molecular Formula | C11H4F15N3O2 |
| Molecular Weight | 495.14 g/mol |
| Exact Mass | 495.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-N-(5-methyl-1,2,4-oxadiazol-3-yl)octanamide |
| SMILES | Cc1nc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)no1 |
| InChI | InChI=1S/C11H4F15N3O2/c1-2-27-4(29-31-2)28-3(30)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h1H3,(H,28,29,30) |
| InChIKey | HETLGEHETYDWJG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.14 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|