C30H36ClN5O3 — CID 10143949
5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide;oxolane;hydrochloride (PubChem CID 10143949) has the molecular formula C30H36ClN5O3 and a molecular weight of 550.10 g/mol. Its IUPAC name is 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide;oxolane;hydrochloride.
| Compound Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide;oxolane;hydrochloride |
|---|---|
| PubChem CID | 10143949 |
| Molecular Formula | C30H36ClN5O3 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxamide;oxolane;hydrochloride |
| SMILES | C1CCOC1.Cl.N#Cc1ccc2[nH]cc(CCCCN3CCN(c4ccc5oc(C(N)=O)cc5c4)CC3)c2c1 |
| InChI | InChI=1S/C26H27N5O2.C4H8O.ClH/c27-16-18-4-6-23-22(13-18)19(17-29-23)3-1-2-8-30-9-11-31(12-10-30)21-5-7-24-20(14-21)15-25(33-24)26(28)32;1-2-4-5-3-1;/h4-7,13-15,17,29H,1-3,8-12H2,(H2,28,32);1-4H2;1H |
| InChIKey | ZOVDUUKYXHBGBK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|