C29H52O4Si2 — CID 101439747
ethyl (E)-3-[(1S,2R,6S,7S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-10-methylidene-7-tricyclo[5.2.1.01,6]decanyl]prop-2-enoate (PubChem CID 101439747) has the molecular formula C29H52O4Si2 and a molecular weight of 520.90 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,2R,6S,7S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-10-methylidene-7-tricyclo[5.2.1.01,6]decanyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,2R,6S,7S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-10-methylidene-7-tricyclo[5.2.1.01,6]decanyl]prop-2-enoate |
|---|---|
| PubChem CID | 101439747 |
| Molecular Formula | C29H52O4Si2 |
| Molecular Weight | 520.90 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | ethyl (E)-3-[(1S,2R,6S,7S,9S)-2,9-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-10-methylidene-7-tricyclo[5.2.1.01,6]decanyl]prop-2-enoate |
| SMILES | C=C1[C@]23[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@]1(/C=C/C(=O)OCC)[C@]2(C)CCC[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H52O4Si2/c1-14-31-24(30)17-19-28-20-23(33-35(12,13)26(6,7)8)29(21(28)2)22(16-15-18-27(28,29)9)32-34(10,11)25(3,4)5/h17,19,22-23H,2,14-16,18,20H2,1,3-13H3/b19-17+/t22-,23+,27+,28-,29+/m1/s1 |
| InChIKey | RNXBODCHOAGDQB-QNIQHXCRSA-N |
| XLogP | 8.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.90 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|