C17H21NO3S — CID 101441202
N-[(E,1S)-1-(furan-2-yl)-2-propan-2-ylbut-2-enyl]benzenesulfonamide (PubChem CID 101441202) has the molecular formula C17H21NO3S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-[(E,1S)-1-(furan-2-yl)-2-propan-2-ylbut-2-enyl]benzenesulfonamide.
| Compound Name | N-[(E,1S)-1-(furan-2-yl)-2-propan-2-ylbut-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101441202 |
| Molecular Formula | C17H21NO3S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[(E,1S)-1-(furan-2-yl)-2-propan-2-ylbut-2-enyl]benzenesulfonamide |
| SMILES | C/C=C(\C(C)C)[C@H](NS(=O)(=O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C17H21NO3S/c1-4-15(13(2)3)17(16-11-8-12-21-16)18-22(19,20)14-9-6-5-7-10-14/h4-13,17-18H,1-3H3/b15-4+/t17-/m0/s1 |
| InChIKey | IOGHFMQNQYTBOL-MYRYOBPOSA-N |
| XLogP | 3.90 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|