C15H14N2O3S — CID 134946791
N-[(1R)-2-cyano-1-(furan-2-yl)prop-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 134946791) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-[(1R)-2-cyano-1-(furan-2-yl)prop-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R)-2-cyano-1-(furan-2-yl)prop-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134946791 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | N-[(1R)-2-cyano-1-(furan-2-yl)prop-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C#N)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccco1 |
| InChI | InChI=1S/C15H14N2O3S/c1-11-5-7-13(8-6-11)21(18,19)17-15(12(2)10-16)14-4-3-9-20-14/h3-9,15,17H,2H2,1H3/t15-/m1/s1 |
| InChIKey | MSJXLBLHOWRGLC-OAHLLOKOSA-N |
| XLogP | 2.69 |
| TPSA | 83.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|