C15H17NO3S — CID 101441203
N-[(E,1S)-1-(furan-2-yl)-2-methylbut-2-enyl]benzenesulfonamide (PubChem CID 101441203) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is N-[(E,1S)-1-(furan-2-yl)-2-methylbut-2-enyl]benzenesulfonamide.
| Compound Name | N-[(E,1S)-1-(furan-2-yl)-2-methylbut-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101441203 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | N-[(E,1S)-1-(furan-2-yl)-2-methylbut-2-enyl]benzenesulfonamide |
| SMILES | C/C=C(\C)[C@H](NS(=O)(=O)c1ccccc1)c1ccco1 |
| InChI | InChI=1S/C15H17NO3S/c1-3-12(2)15(14-10-7-11-19-14)16-20(17,18)13-8-5-4-6-9-13/h3-11,15-16H,1-2H3/b12-3+/t15-/m0/s1 |
| InChIKey | JXBGCVUXYDPNAY-COHQTCMYSA-N |
| XLogP | 3.27 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|