C30H34N2O4 — CID 101441289
ditert-butyl (1S,2R,3R,12S,14R,15S)-13,22-diazahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene-13,22-dicarboxylate (PubChem CID 101441289) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is ditert-butyl (1S,2R,3R,12S,14R,15S)-13,22-diazahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene-13,22-dicarboxylate.
| Compound Name | ditert-butyl (1S,2R,3R,12S,14R,15S)-13,22-diazahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene-13,22-dicarboxylate |
|---|---|
| PubChem CID | 101441289 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | ditert-butyl (1S,2R,3R,12S,14R,15S)-13,22-diazahexacyclo[13.6.1.02,14.03,12.06,11.016,21]docosa-4,6,8,10,16,18,20-heptaene-13,22-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2[C@H]([C@H]3C=Cc4ccccc4[C@H]31)[C@H]1c3ccccc3[C@@H]2N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H34N2O4/c1-29(2,3)35-27(33)31-23-18-12-8-7-11-17(18)15-16-21(23)22-24-19-13-9-10-14-20(19)25(26(22)31)32(24)28(34)36-30(4,5)6/h7-16,21-26H,1-6H3/t21-,22-,23-,24-,25+,26-/m1/s1 |
| InChIKey | BIKHDPNOIBSTHX-DWWGGXHQSA-N |
| XLogP | 6.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |