C44H49N2O+ — CID 101442820
4-[(S)-1-adamantyloxy-[(1S,2R,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline (PubChem CID 101442820) has the molecular formula C44H49N2O+ and a molecular weight of 621.89 g/mol. Its IUPAC name is 4-[(S)-1-adamantyloxy-[(1S,2R,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline.
| Compound Name | 4-[(S)-1-adamantyloxy-[(1S,2R,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
|---|---|
| PubChem CID | 101442820 |
| Molecular Formula | C44H49N2O+ |
| Molecular Weight | 621.89 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | 4-[(S)-1-adamantyloxy-[(1S,2R,4S,5R)-1-(anthracen-9-ylmethyl)-5-ethyl-1-azoniabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
| SMILES | CC[C@H]1C[N@+]2(Cc3c4ccccc4cc4ccccc34)CC[C@H]1C[C@@H]2[C@@H](OC12CC3CC(CC(C3)C1)C2)c1ccnc2ccccc12 |
| InChI | InChI=1S/C44H49N2O/c1-2-32-27-46(28-40-36-11-5-3-9-34(36)22-35-10-4-6-12-37(35)40)18-16-33(32)23-42(46)43(39-15-17-45-41-14-8-7-13-38(39)41)47-44-24-29-19-30(25-44)21-31(20-29)26-44/h3-15,17,22,29-33,42-43H,2,16,18-21,23-28H2,1H3/q+1/t29?,30?,31?,32-,33-,42+,43-,44?,46-/m0/s1 |
| InChIKey | UDRGJZIJYBEVID-REAHUJGJSA-N |
| XLogP | 10.40 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.89 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|