C24H27Cl3N2O5S — CID 10144352
[5-chloro-2-(2,4-dichlorophenoxy)phenyl] 2-[(2-formamido-4-methylsulfanylbutanoyl)amino]-4-methylpentanoate (PubChem CID 10144352) has the molecular formula C24H27Cl3N2O5S and a molecular weight of 561.92 g/mol. Its IUPAC name is [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 2-[(2-formamido-4-methylsulfanylbutanoyl)amino]-4-methylpentanoate.
| Compound Name | [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 2-[(2-formamido-4-methylsulfanylbutanoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 10144352 |
| Molecular Formula | C24H27Cl3N2O5S |
| Molecular Weight | 561.92 g/mol |
| Exact Mass | 560.07 |
| IUPAC Name | [5-chloro-2-(2,4-dichlorophenoxy)phenyl] 2-[(2-formamido-4-methylsulfanylbutanoyl)amino]-4-methylpentanoate |
| SMILES | CSCCC(NC=O)C(=O)NC(CC(C)C)C(=O)Oc1cc(Cl)ccc1Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H27Cl3N2O5S/c1-14(2)10-19(29-23(31)18(28-13-30)8-9-35-3)24(32)34-22-12-16(26)5-7-21(22)33-20-6-4-15(25)11-17(20)27/h4-7,11-14,18-19H,8-10H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | HEHXVCVZYTWCTE-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.92 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|