C19H32N2O5S — CID 159623920
[4-(hydroxymethyl)phenyl] (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen (PubChem CID 159623920) has the molecular formula C19H32N2O5S and a molecular weight of 400.54 g/mol. Its IUPAC name is [4-(hydroxymethyl)phenyl] (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen.
| Compound Name | [4-(hydroxymethyl)phenyl] (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen |
|---|---|
| PubChem CID | 159623920 |
| Molecular Formula | C19H32N2O5S |
| Molecular Weight | 400.54 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | [4-(hydroxymethyl)phenyl] (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@@H](CC(C)C)C(=O)Oc1ccc(CO)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C19H28N2O5S.2H2/c1-13(2)10-17(21-18(24)16(20-12-23)8-9-27-3)19(25)26-15-6-4-14(11-22)5-7-15;;/h4-7,12-13,16-17,22H,8-11H2,1-3H3,(H,20,23)(H,21,24);2*1H/t16-,17-;;/m0../s1 |
| InChIKey | MOFZDWFRJWUBPZ-SZKOKKDDSA-N |
| XLogP | 1.97 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.54 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|