C19H30N2O5S — CID 158133220
(4-formylphenyl) (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen (PubChem CID 158133220) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is (4-formylphenyl) (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen.
| Compound Name | (4-formylphenyl) (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen |
|---|---|
| PubChem CID | 158133220 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | (4-formylphenyl) (2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate;molecular hydrogen |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@@H](CC(C)C)C(=O)Oc1ccc(C=O)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C19H26N2O5S.2H2/c1-13(2)10-17(21-18(24)16(20-12-23)8-9-27-3)19(25)26-15-6-4-14(11-22)5-7-15;;/h4-7,11-13,16-17H,8-10H2,1-3H3,(H,20,23)(H,21,24);2*1H/t16-,17-;;/m0../s1 |
| InChIKey | FTANHGKHQZTJBF-SZKOKKDDSA-N |
| XLogP | 2.30 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|