C17H27N3O5S — CID 122432958
(2S)-N-[(3S)-1-(2,5-dioxopyrrolidin-1-yl)-5-methyl-2-oxohexan-3-yl]-2-formamido-4-methylsulfanylbutanamide (PubChem CID 122432958) has the molecular formula C17H27N3O5S and a molecular weight of 385.49 g/mol. Its IUPAC name is (2S)-N-[(3S)-1-(2,5-dioxopyrrolidin-1-yl)-5-methyl-2-oxohexan-3-yl]-2-formamido-4-methylsulfanylbutanamide.
| Compound Name | (2S)-N-[(3S)-1-(2,5-dioxopyrrolidin-1-yl)-5-methyl-2-oxohexan-3-yl]-2-formamido-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 122432958 |
| Molecular Formula | C17H27N3O5S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2S)-N-[(3S)-1-(2,5-dioxopyrrolidin-1-yl)-5-methyl-2-oxohexan-3-yl]-2-formamido-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@@H](CC(C)C)C(=O)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C17H27N3O5S/c1-11(2)8-13(14(22)9-20-15(23)4-5-16(20)24)19-17(25)12(18-10-21)6-7-26-3/h10-13H,4-9H2,1-3H3,(H,18,21)(H,19,25)/t12-,13-/m0/s1 |
| InChIKey | ZLEHWFPUGPRJCY-STQMWFEESA-N |
| XLogP | 0.10 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|