C29H25NO6 — CID 101444287
2-[(2R,3R,4R,5R,6S)-5-hydroxy-2-methoxy-6-(2-phenylethynyl)-4-phenylmethoxyoxan-3-yl]isoindole-1,3-dione (PubChem CID 101444287) has the molecular formula C29H25NO6 and a molecular weight of 483.52 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R,6S)-5-hydroxy-2-methoxy-6-(2-phenylethynyl)-4-phenylmethoxyoxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,3R,4R,5R,6S)-5-hydroxy-2-methoxy-6-(2-phenylethynyl)-4-phenylmethoxyoxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 101444287 |
| Molecular Formula | C29H25NO6 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[(2R,3R,4R,5R,6S)-5-hydroxy-2-methoxy-6-(2-phenylethynyl)-4-phenylmethoxyoxan-3-yl]isoindole-1,3-dione |
| SMILES | CO[C@@H]1O[C@@H](C#Cc2ccccc2)[C@@H](O)[C@H](OCc2ccccc2)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C29H25NO6/c1-34-29-24(30-27(32)21-14-8-9-15-22(21)28(30)33)26(35-18-20-12-6-3-7-13-20)25(31)23(36-29)17-16-19-10-4-2-5-11-19/h2-15,23-26,29,31H,18H2,1H3/t23-,24+,25+,26+,29+/m0/s1 |
| InChIKey | ZPKZPYZMJWLHGL-JKMMNVDNSA-N |
| XLogP | 3.02 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|