C18H17N3O4S — CID 101444470
[2-amino-6-(4-methoxyphenyl)pyrimidin-4-yl] 4-methylbenzenesulfonate (PubChem CID 101444470) has the molecular formula C18H17N3O4S and a molecular weight of 371.42 g/mol. Its IUPAC name is [2-amino-6-(4-methoxyphenyl)pyrimidin-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-amino-6-(4-methoxyphenyl)pyrimidin-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101444470 |
| Molecular Formula | C18H17N3O4S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [2-amino-6-(4-methoxyphenyl)pyrimidin-4-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(-c2cc(OS(=O)(=O)c3ccc(C)cc3)nc(N)n2)cc1 |
| InChI | InChI=1S/C18H17N3O4S/c1-12-3-9-15(10-4-12)26(22,23)25-17-11-16(20-18(19)21-17)13-5-7-14(24-2)8-6-13/h3-11H,1-2H3,(H2,19,20,21) |
| InChIKey | XYGGEWPTVCPEQV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|