C12H15NO2 — CID 101444932
propan-2-yl (1S,2S,3R,4R)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 101444932) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is propan-2-yl (1S,2S,3R,4R)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | propan-2-yl (1S,2S,3R,4R)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 101444932 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | propan-2-yl (1S,2S,3R,4R)-3-cyanobicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1[C@H](C#N)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C12H15NO2/c1-7(2)15-12(14)11-9-4-3-8(5-9)10(11)6-13/h3-4,7-11H,5H2,1-2H3/t8-,9+,10+,11-/m0/s1 |
| InChIKey | BRDVMMIKNQXWTG-ZDCRXTMVSA-N |
| XLogP | 1.90 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|