C13H19NO5S — CID 10891965
propan-2-yl (1S,2R,3S,4R)-3-(methylsulfonylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10891965) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is propan-2-yl (1S,2R,3S,4R)-3-(methylsulfonylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | propan-2-yl (1S,2R,3S,4R)-3-(methylsulfonylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10891965 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | propan-2-yl (1S,2R,3S,4R)-3-(methylsulfonylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)OC(=O)[C@H]1[C@@H](C(=O)NS(C)(=O)=O)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C13H19NO5S/c1-7(2)19-13(16)11-9-5-4-8(6-9)10(11)12(15)14-20(3,17)18/h4-5,7-11H,6H2,1-3H3,(H,14,15)/t8-,9+,10-,11+/m0/s1 |
| InChIKey | ZUGTWEGCRPNGDS-ZRUFSTJUSA-N |
| XLogP | 0.45 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|