C19H21Cl2NO3 — CID 18556814
1,3-dichloropropan-2-yl (1R,2S,3R,4R)-3-[(4-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18556814) has the molecular formula C19H21Cl2NO3 and a molecular weight of 382.29 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl (1R,2S,3R,4R)-3-[(4-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 1,3-dichloropropan-2-yl (1R,2S,3R,4R)-3-[(4-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18556814 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1,3-dichloropropan-2-yl (1R,2S,3R,4R)-3-[(4-methylphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@H]2[C@@H](C(=O)OC(CCl)CCl)[C@H]3C=C[C@H]2C3)cc1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-11-2-6-14(7-3-11)22-18(23)16-12-4-5-13(8-12)17(16)19(24)25-15(9-20)10-21/h2-7,12-13,15-17H,8-10H2,1H3,(H,22,23)/t12-,13-,16+,17-/m0/s1 |
| InChIKey | CKRBMAIGKLWNGT-CLROSIBMSA-N |
| XLogP | 3.76 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|