C19H18Cl2N2O3S — CID 98368936
1,3-dichloropropan-2-yl (1R,2S,3S,4R)-3-(1,3-benzothiazol-2-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 98368936) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is 1,3-dichloropropan-2-yl (1R,2S,3S,4R)-3-(1,3-benzothiazol-2-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 1,3-dichloropropan-2-yl (1R,2S,3S,4R)-3-(1,3-benzothiazol-2-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 98368936 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 1,3-dichloropropan-2-yl (1R,2S,3S,4R)-3-(1,3-benzothiazol-2-ylcarbamoyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(Nc1nc2ccccc2s1)[C@@H]1[C@@H](C(=O)OC(CCl)CCl)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C19H18Cl2N2O3S/c20-8-12(9-21)26-18(25)16-11-6-5-10(7-11)15(16)17(24)23-19-22-13-3-1-2-4-14(13)27-19/h1-6,10-12,15-16H,7-9H2,(H,22,23,24)/t10-,11-,15-,16-/m0/s1 |
| InChIKey | AEOWODMAAPJXJN-GREKMHCPSA-N |
| XLogP | 4.06 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|