C10H11N5O5 — CID 101446684
1-[(3R,3aR,5R,6R,6aR)-6-azido-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]pyrimidine-2,4-dione (PubChem CID 101446684) has the molecular formula C10H11N5O5 and a molecular weight of 281.23 g/mol. Its IUPAC name is 1-[(3R,3aR,5R,6R,6aR)-6-azido-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3R,3aR,5R,6R,6aR)-6-azido-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101446684 |
| Molecular Formula | C10H11N5O5 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-[(3R,3aR,5R,6R,6aR)-6-azido-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-5-yl]pyrimidine-2,4-dione |
| SMILES | [N-]=[N+]=N[C@@H]1[C@H]2OC[C@@H](O)[C@H]2O[C@H]1n1ccc(=O)[nH]c1=O |
| InChI | InChI=1S/C10H11N5O5/c11-14-13-6-8-7(4(16)3-19-8)20-9(6)15-2-1-5(17)12-10(15)18/h1-2,4,6-9,16H,3H2,(H,12,17,18)/t4-,6-,7-,8-,9-/m1/s1 |
| InChIKey | ABJLCPDUMIUVID-GPMKSPRZSA-N |
| XLogP | -1.13 |
| TPSA | 142.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|