C12H10ClN3O2 — CID 101450831
methyl (2Z,4Z)-2-azido-4-chloro-5-phenylpenta-2,4-dienoate (PubChem CID 101450831) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is methyl (2Z,4Z)-2-azido-4-chloro-5-phenylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4Z)-2-azido-4-chloro-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 101450831 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | methyl (2Z,4Z)-2-azido-4-chloro-5-phenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C(Cl)=C/c1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C12H10ClN3O2/c1-18-12(17)11(15-16-14)8-10(13)7-9-5-3-2-4-6-9/h2-8H,1H3/b10-7-,11-8- |
| InChIKey | ILNGJEHUGCDHSC-DEFDFUCDSA-N |
| XLogP | 3.63 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|