C13H16N4O3 — CID 102087708
methyl (Z)-2-azido-3-[1-(2,2-dimethylpropanoyl)pyrrol-2-yl]prop-2-enoate (PubChem CID 102087708) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is methyl (Z)-2-azido-3-[1-(2,2-dimethylpropanoyl)pyrrol-2-yl]prop-2-enoate.
| Compound Name | methyl (Z)-2-azido-3-[1-(2,2-dimethylpropanoyl)pyrrol-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102087708 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | methyl (Z)-2-azido-3-[1-(2,2-dimethylpropanoyl)pyrrol-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C(=C/c1cccn1C(=O)C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C13H16N4O3/c1-13(2,3)12(19)17-7-5-6-9(17)8-10(15-16-14)11(18)20-4/h5-8H,1-4H3/b10-8- |
| InChIKey | FCFSLMLZRZJVCM-NTMALXAHSA-N |
| XLogP | 3.00 |
| TPSA | 97.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|