C30H36O7 — CID 101455035
3-O,4-O-ditert-butyl 5-O-ethyl 2-(4-methylphenyl)-5-phenyl-2H-furan-3,4,5-tricarboxylate (PubChem CID 101455035) has the molecular formula C30H36O7 and a molecular weight of 508.61 g/mol. Its IUPAC name is 3-O,4-O-ditert-butyl 5-O-ethyl 2-(4-methylphenyl)-5-phenyl-2H-furan-3,4,5-tricarboxylate.
| Compound Name | 3-O,4-O-ditert-butyl 5-O-ethyl 2-(4-methylphenyl)-5-phenyl-2H-furan-3,4,5-tricarboxylate |
|---|---|
| PubChem CID | 101455035 |
| Molecular Formula | C30H36O7 |
| Molecular Weight | 508.61 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 3-O,4-O-ditert-butyl 5-O-ethyl 2-(4-methylphenyl)-5-phenyl-2H-furan-3,4,5-tricarboxylate |
| SMILES | CCOC(=O)C1(c2ccccc2)OC(c2ccc(C)cc2)C(C(=O)OC(C)(C)C)=C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H36O7/c1-9-34-27(33)30(21-13-11-10-12-14-21)23(26(32)37-29(6,7)8)22(25(31)36-28(3,4)5)24(35-30)20-17-15-19(2)16-18-20/h10-18,24H,9H2,1-8H3 |
| InChIKey | DZOISFONJYJSQB-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.61 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|